C15H24N2O2S — CID 106475975
6-tert-butyl-2-(4-ethoxyoxan-4-yl)-1H-pyrimidine-4-thione (PubChem CID 106475975) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 6-tert-butyl-2-(4-ethoxyoxan-4-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-tert-butyl-2-(4-ethoxyoxan-4-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475975 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 6-tert-butyl-2-(4-ethoxyoxan-4-yl)-1H-pyrimidine-4-thione |
| SMILES | CCOC1(c2nc(=S)cc(C(C)(C)C)[nH]2)CCOCC1 |
| InChI | InChI=1S/C15H24N2O2S/c1-5-19-15(6-8-18-9-7-15)13-16-11(14(2,3)4)10-12(20)17-13/h10H,5-9H2,1-4H3,(H,16,17,20) |
| InChIKey | WGVBIYYWAYCURK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|