C12H18N2OS — CID 106476035
6-tert-butyl-2-(oxolan-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106476035) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 6-tert-butyl-2-(oxolan-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-tert-butyl-2-(oxolan-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476035 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6-tert-butyl-2-(oxolan-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)(C)c1cc(=S)nc(C2CCCO2)[nH]1 |
| InChI | InChI=1S/C12H18N2OS/c1-12(2,3)9-7-10(16)14-11(13-9)8-5-4-6-15-8/h7-8H,4-6H2,1-3H3,(H,13,14,16) |
| InChIKey | SRGMCNWTRVEKOE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|