C26H18ClNO5 — CID 10647618
5-chloro-2-hydroxy-3-[(E)-3-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enoyl]benzoic acid (PubChem CID 10647618) has the molecular formula C26H18ClNO5 and a molecular weight of 459.89 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-3-[(E)-3-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enoyl]benzoic acid.
| Compound Name | 5-chloro-2-hydroxy-3-[(E)-3-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 10647618 |
| Molecular Formula | C26H18ClNO5 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 5-chloro-2-hydroxy-3-[(E)-3-[4-(quinolin-2-ylmethoxy)phenyl]prop-2-enoyl]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(C(=O)/C=C/c2ccc(OCc3ccc4ccccc4n3)cc2)c1O |
| InChI | InChI=1S/C26H18ClNO5/c27-18-13-21(25(30)22(14-18)26(31)32)24(29)12-7-16-5-10-20(11-6-16)33-15-19-9-8-17-3-1-2-4-23(17)28-19/h1-14,30H,15H2,(H,31,32)/b12-7+ |
| InChIKey | RLCNRWRACMSPHG-KPKJPENVSA-N |
| XLogP | 5.77 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|