C10H16N4S — CID 106476402
2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-6-thione (PubChem CID 106476402) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-6-thione.
| Compound Name | 2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 106476402 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2-(1,4-dimethylpiperazin-2-yl)-1H-pyrimidine-6-thione |
| SMILES | CN1CCN(C)C(c2nccc(=S)[nH]2)C1 |
| InChI | InChI=1S/C10H16N4S/c1-13-5-6-14(2)8(7-13)10-11-4-3-9(15)12-10/h3-4,8H,5-7H2,1-2H3,(H,11,12,15) |
| InChIKey | PYQFDJSZBHUAIW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|