C11H17BrN4S — CID 106480944
5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-6-thione (PubChem CID 106480944) has the molecular formula C11H17BrN4S and a molecular weight of 317.26 g/mol. Its IUPAC name is 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-6-thione.
| Compound Name | 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 106480944 |
| Molecular Formula | C11H17BrN4S |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-bromo-2-[(1,4-dimethylpiperazin-2-yl)methyl]-1H-pyrimidine-6-thione |
| SMILES | CN1CCN(C)C(Cc2ncc(Br)c(=S)[nH]2)C1 |
| InChI | InChI=1S/C11H17BrN4S/c1-15-3-4-16(2)8(7-15)5-10-13-6-9(12)11(17)14-10/h6,8H,3-5,7H2,1-2H3,(H,13,14,17) |
| InChIKey | FSNWVMYBWTUQIC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|