C15H24N2OS — CID 106476711
2-(1-methoxy-4,4-dimethylcyclohexyl)-5,6-dimethyl-1H-pyrimidine-4-thione (PubChem CID 106476711) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-(1-methoxy-4,4-dimethylcyclohexyl)-5,6-dimethyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(1-methoxy-4,4-dimethylcyclohexyl)-5,6-dimethyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476711 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(1-methoxy-4,4-dimethylcyclohexyl)-5,6-dimethyl-1H-pyrimidine-4-thione |
| SMILES | COC1(c2nc(=S)c(C)c(C)[nH]2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H24N2OS/c1-10-11(2)16-13(17-12(10)19)15(18-5)8-6-14(3,4)7-9-15/h6-9H2,1-5H3,(H,16,17,19) |
| InChIKey | WXMGPYSBMLKWKQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|