C14H24N2OS — CID 106476956
2-(3-ethoxypentan-3-yl)-5-ethyl-6-methyl-1H-pyrimidine-4-thione (PubChem CID 106476956) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-(3-ethoxypentan-3-yl)-5-ethyl-6-methyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(3-ethoxypentan-3-yl)-5-ethyl-6-methyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106476956 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-(3-ethoxypentan-3-yl)-5-ethyl-6-methyl-1H-pyrimidine-4-thione |
| SMILES | CCOC(CC)(CC)c1nc(=S)c(CC)c(C)[nH]1 |
| InChI | InChI=1S/C14H24N2OS/c1-6-11-10(5)15-13(16-12(11)18)14(7-2,8-3)17-9-4/h6-9H2,1-5H3,(H,15,16,18) |
| InChIKey | RMEMSXJEMCLFBA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|