C13H20N2O2S — CID 106477142
2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione (PubChem CID 106477142) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione.
| Compound Name | 2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
|---|---|
| PubChem CID | 106477142 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethyl]-5,6,7,8-tetrahydro-1H-quinazoline-4-thione |
| SMILES | COCCOCCc1nc(=S)c2c([nH]1)CCCC2 |
| InChI | InChI=1S/C13H20N2O2S/c1-16-8-9-17-7-6-12-14-11-5-3-2-4-10(11)13(18)15-12/h2-9H2,1H3,(H,14,15,18) |
| InChIKey | PHIIENQIOUARAQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|