C9H14N2S — CID 106477834
2,6-dimethyl-5-propan-2-yl-1H-pyrimidine-4-thione (PubChem CID 106477834) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 2,6-dimethyl-5-propan-2-yl-1H-pyrimidine-4-thione.
| Compound Name | 2,6-dimethyl-5-propan-2-yl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477834 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,6-dimethyl-5-propan-2-yl-1H-pyrimidine-4-thione |
| SMILES | Cc1nc(=S)c(C(C)C)c(C)[nH]1 |
| InChI | InChI=1S/C9H14N2S/c1-5(2)8-6(3)10-7(4)11-9(8)12/h5H,1-4H3,(H,10,11,12) |
| InChIKey | ZMUUJQWKGYYGIN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|