C13H11FN2S — CID 106478359
6-cyclopropyl-2-(3-fluorophenyl)-1H-pyrimidine-4-thione (PubChem CID 106478359) has the molecular formula C13H11FN2S and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-cyclopropyl-2-(3-fluorophenyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopropyl-2-(3-fluorophenyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478359 |
| Molecular Formula | C13H11FN2S |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 6-cyclopropyl-2-(3-fluorophenyl)-1H-pyrimidine-4-thione |
| SMILES | Fc1cccc(-c2nc(=S)cc(C3CC3)[nH]2)c1 |
| InChI | InChI=1S/C13H11FN2S/c14-10-3-1-2-9(6-10)13-15-11(8-4-5-8)7-12(17)16-13/h1-3,6-8H,4-5H2,(H,15,16,17) |
| InChIKey | FMDZFBIBPZXJKV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|