C9H7FN4S — CID 115279054
2-amino-6-(3-fluorophenyl)-1H-1,3,5-triazine-4-thione (PubChem CID 115279054) has the molecular formula C9H7FN4S and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-amino-6-(3-fluorophenyl)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-amino-6-(3-fluorophenyl)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 115279054 |
| Molecular Formula | C9H7FN4S |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 2-amino-6-(3-fluorophenyl)-1H-1,3,5-triazine-4-thione |
| SMILES | Nc1nc(=S)nc(-c2cccc(F)c2)[nH]1 |
| InChI | InChI=1S/C9H7FN4S/c10-6-3-1-2-5(4-6)7-12-8(11)14-9(15)13-7/h1-4H,(H3,11,12,13,14,15) |
| InChIKey | GBWZVWRNHODERE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|