C9H9N5S — CID 83241208
2-amino-6-(6-methyl-2-pyridinyl)-1H-1,3,5-triazine-4-thione (PubChem CID 83241208) has the molecular formula C9H9N5S and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-amino-6-(6-methyl-2-pyridinyl)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-amino-6-(6-methyl-2-pyridinyl)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 83241208 |
| Molecular Formula | C9H9N5S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-amino-6-(6-methyl-2-pyridinyl)-1H-1,3,5-triazine-4-thione |
| SMILES | Cc1cccc(-c2nc(=S)nc(N)[nH]2)n1 |
| InChI | InChI=1S/C9H9N5S/c1-5-3-2-4-6(11-5)7-12-8(10)14-9(15)13-7/h2-4H,1H3,(H3,10,12,13,14,15) |
| InChIKey | FJLVZUSJBXAEPA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|