C11H12N4S — CID 115279072
2-amino-6-(4-ethylphenyl)-1H-1,3,5-triazine-4-thione (PubChem CID 115279072) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-amino-6-(4-ethylphenyl)-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-amino-6-(4-ethylphenyl)-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 115279072 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-amino-6-(4-ethylphenyl)-1H-1,3,5-triazine-4-thione |
| SMILES | CCc1ccc(-c2nc(=S)nc(N)[nH]2)cc1 |
| InChI | InChI=1S/C11H12N4S/c1-2-7-3-5-8(6-4-7)9-13-10(12)15-11(16)14-9/h3-6H,2H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | JNNICIDBCURRGS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|