C10H7N5S — CID 115279085
3-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 115279085) has the molecular formula C10H7N5S and a molecular weight of 229.27 g/mol. Its IUPAC name is 3-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 3-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 115279085 |
| Molecular Formula | C10H7N5S |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 3-(6-amino-4-sulfanylidene-1H-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nc(=S)nc(N)[nH]2)c1 |
| InChI | InChI=1S/C10H7N5S/c11-5-6-2-1-3-7(4-6)8-13-9(12)15-10(16)14-8/h1-4H,(H3,12,13,14,15,16) |
| InChIKey | QGGWZPCEYVJXIO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|