C10H6N2OS — CID 106798998
3-(2-sulfanylidene-3H-1,3-oxazol-4-yl)benzonitrile (PubChem CID 106798998) has the molecular formula C10H6N2OS and a molecular weight of 202.24 g/mol. Its IUPAC name is 3-(2-sulfanylidene-3H-1,3-oxazol-4-yl)benzonitrile.
| Compound Name | 3-(2-sulfanylidene-3H-1,3-oxazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 106798998 |
| Molecular Formula | C10H6N2OS |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 3-(2-sulfanylidene-3H-1,3-oxazol-4-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2coc(=S)[nH]2)c1 |
| InChI | InChI=1S/C10H6N2OS/c11-5-7-2-1-3-8(4-7)9-6-13-10(14)12-9/h1-4,6H,(H,12,14) |
| InChIKey | MYDIWEGOXUMNLQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|