C15H12N4O — CID 79815989
3-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)benzonitrile (PubChem CID 79815989) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 3-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)benzonitrile.
| Compound Name | 3-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 79815989 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)benzonitrile |
| SMILES | CCOc1ccc2[nH]c(-c3cccc(C#N)c3)nc2n1 |
| InChI | InChI=1S/C15H12N4O/c1-2-20-13-7-6-12-15(18-13)19-14(17-12)11-5-3-4-10(8-11)9-16/h3-8H,2H2,1H3,(H,17,18,19) |
| InChIKey | NLACCTIEHLITPX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |