About 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine
2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine (PubChem CID 79815768) has the molecular formula C14H11F2N3O
and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 79815768 |
| Molecular Formula | C14H11F2N3O |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine |
| SMILES | CCOc1ccc2[nH]c(-c3cc(F)ccc3F)nc2n1 |
| InChI | InChI=1S/C14H11F2N3O/c1-2-20-12-6-5-11-14(18-12)19-13(17-11)9-7-8(15)3-4-10(9)16/h3-7H,2H2,1H3,(H,17,18,19) |
| InChIKey | WPSRAZBPWSALLW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine (CID 79815768) is 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine is CCOc1ccc2[nH]c(-c3cc(F)ccc3F)nc2n1.
What is the InChIKey of 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine?
The InChIKey is WPSRAZBPWSALLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2N3O/c1-2-20-12-6-5-11-14(18-12)19-13(17-11)9-7-8(15)3-4-10(9)16/h3-7H,2H2,1H3,(H,17,18,19).
What are the key properties of 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine?
2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine has a molecular weight of 275.26 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorophenyl)-5-ethoxy-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 79815768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).