C9H13BrN2S2 — CID 106479213
5-bromo-6-methyl-2-(propylsulfanylmethyl)-1H-pyrimidine-4-thione (PubChem CID 106479213) has the molecular formula C9H13BrN2S2 and a molecular weight of 293.26 g/mol. Its IUPAC name is 5-bromo-6-methyl-2-(propylsulfanylmethyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-methyl-2-(propylsulfanylmethyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479213 |
| Molecular Formula | C9H13BrN2S2 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 5-bromo-6-methyl-2-(propylsulfanylmethyl)-1H-pyrimidine-4-thione |
| SMILES | CCCSCc1nc(=S)c(Br)c(C)[nH]1 |
| InChI | InChI=1S/C9H13BrN2S2/c1-3-4-14-5-7-11-6(2)8(10)9(13)12-7/h3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | ZZBCXWXTTHSRBH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|