C27H31ClN2O3 — CID 10647933
(1S,2S,13R,21R)-22-(3-methylbutyl)-14-oxa-22-aza-11-azoniaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaene-2,16-diol chloride (PubChem CID 10647933) has the molecular formula C27H31ClN2O3 and a molecular weight of 467.01 g/mol. Its IUPAC name is (1S,2S,13R,21R)-22-(3-methylbutyl)-14-oxa-22-aza-11-azoniaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaene-2,16-diol chloride.
| Compound Name | (1S,2S,13R,21R)-22-(3-methylbutyl)-14-oxa-22-aza-11-azoniaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaene-2,16-diol chloride |
|---|---|
| PubChem CID | 10647933 |
| Molecular Formula | C27H31ClN2O3 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (1S,2S,13R,21R)-22-(3-methylbutyl)-14-oxa-22-aza-11-azoniaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaene-2,16-diol chloride |
| SMILES | CC(C)CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2C2=C(C[C@@]3(O)[C@H]1C5)c1ccccc1[NH2+]2.[Cl-] |
| InChI | InChI=1S/C27H30N2O3.ClH/c1-15(2)9-11-29-12-10-26-22-16-7-8-20(30)24(22)32-25(26)23-18(14-27(26,31)21(29)13-16)17-5-3-4-6-19(17)28-23;/h3-8,15,21,25,28,30-31H,9-14H2,1-2H3;1H/t21-,25+,26+,27-;/m1./s1 |
| InChIKey | PUGKCNRNWOQQJE-ZHXLFDHXSA-N |
| XLogP | -0.17 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|