C12H18BrN3OS — CID 106479396
5-bromo-2-(4-methylmorpholin-2-yl)-6-propyl-1H-pyrimidine-4-thione (PubChem CID 106479396) has the molecular formula C12H18BrN3OS and a molecular weight of 332.27 g/mol. Its IUPAC name is 5-bromo-2-(4-methylmorpholin-2-yl)-6-propyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(4-methylmorpholin-2-yl)-6-propyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479396 |
| Molecular Formula | C12H18BrN3OS |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 5-bromo-2-(4-methylmorpholin-2-yl)-6-propyl-1H-pyrimidine-4-thione |
| SMILES | CCCc1[nH]c(C2CN(C)CCO2)nc(=S)c1Br |
| InChI | InChI=1S/C12H18BrN3OS/c1-3-4-8-10(13)12(18)15-11(14-8)9-7-16(2)5-6-17-9/h9H,3-7H2,1-2H3,(H,14,15,18) |
| InChIKey | OJXDREZYLRVRBB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|