C14H21BrN2S — CID 106479611
5-bromo-6-tert-butyl-2-(3-methylcyclopentyl)-1H-pyrimidine-4-thione (PubChem CID 106479611) has the molecular formula C14H21BrN2S and a molecular weight of 329.31 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-(3-methylcyclopentyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-tert-butyl-2-(3-methylcyclopentyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479611 |
| Molecular Formula | C14H21BrN2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-(3-methylcyclopentyl)-1H-pyrimidine-4-thione |
| SMILES | CC1CCC(c2nc(=S)c(Br)c(C(C)(C)C)[nH]2)C1 |
| InChI | InChI=1S/C14H21BrN2S/c1-8-5-6-9(7-8)12-16-11(14(2,3)4)10(15)13(18)17-12/h8-9H,5-7H2,1-4H3,(H,16,17,18) |
| InChIKey | VMXZSJAYZMRQGV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|