C12H20BrN3S — CID 106479640
5-bromo-6-tert-butyl-2-(diethylamino)-1H-pyrimidine-4-thione (PubChem CID 106479640) has the molecular formula C12H20BrN3S and a molecular weight of 318.28 g/mol. Its IUPAC name is 5-bromo-6-tert-butyl-2-(diethylamino)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-tert-butyl-2-(diethylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479640 |
| Molecular Formula | C12H20BrN3S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 5-bromo-6-tert-butyl-2-(diethylamino)-1H-pyrimidine-4-thione |
| SMILES | CCN(CC)c1nc(=S)c(Br)c(C(C)(C)C)[nH]1 |
| InChI | InChI=1S/C12H20BrN3S/c1-6-16(7-2)11-14-9(12(3,4)5)8(13)10(17)15-11/h6-7H2,1-5H3,(H,14,15,17) |
| InChIKey | INYPVXJXHPYGAU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|