C9H8BrN3S2 — CID 106479987
5-bromo-6-ethyl-2-(1,3-thiazol-5-yl)-1H-pyrimidine-4-thione (PubChem CID 106479987) has the molecular formula C9H8BrN3S2 and a molecular weight of 302.22 g/mol. Its IUPAC name is 5-bromo-6-ethyl-2-(1,3-thiazol-5-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-ethyl-2-(1,3-thiazol-5-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479987 |
| Molecular Formula | C9H8BrN3S2 |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 300.93 |
| IUPAC Name | 5-bromo-6-ethyl-2-(1,3-thiazol-5-yl)-1H-pyrimidine-4-thione |
| SMILES | CCc1[nH]c(-c2cncs2)nc(=S)c1Br |
| InChI | InChI=1S/C9H8BrN3S2/c1-2-5-7(10)9(14)13-8(12-5)6-3-11-4-15-6/h3-4H,2H2,1H3,(H,12,13,14) |
| InChIKey | DOBRFWBOXIETPO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|