C8H6BrN3S2 — CID 106479222
5-bromo-6-methyl-2-(1,3-thiazol-5-yl)-1H-pyrimidine-4-thione (PubChem CID 106479222) has the molecular formula C8H6BrN3S2 and a molecular weight of 288.20 g/mol. Its IUPAC name is 5-bromo-6-methyl-2-(1,3-thiazol-5-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-methyl-2-(1,3-thiazol-5-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106479222 |
| Molecular Formula | C8H6BrN3S2 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 286.92 |
| IUPAC Name | 5-bromo-6-methyl-2-(1,3-thiazol-5-yl)-1H-pyrimidine-4-thione |
| SMILES | Cc1[nH]c(-c2cncs2)nc(=S)c1Br |
| InChI | InChI=1S/C8H6BrN3S2/c1-4-6(9)8(13)12-7(11-4)5-2-10-3-14-5/h2-3H,1H3,(H,11,12,13) |
| InChIKey | XZSNVIWNPVPXAF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|