C13H9BrClFN2S — CID 106480485
5-bromo-2-(2-chloro-4-fluorophenyl)-6-cyclopropyl-1H-pyrimidine-4-thione (PubChem CID 106480485) has the molecular formula C13H9BrClFN2S and a molecular weight of 359.65 g/mol. Its IUPAC name is 5-bromo-2-(2-chloro-4-fluorophenyl)-6-cyclopropyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(2-chloro-4-fluorophenyl)-6-cyclopropyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106480485 |
| Molecular Formula | C13H9BrClFN2S |
| Molecular Weight | 359.65 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 5-bromo-2-(2-chloro-4-fluorophenyl)-6-cyclopropyl-1H-pyrimidine-4-thione |
| SMILES | Fc1ccc(-c2nc(=S)c(Br)c(C3CC3)[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C13H9BrClFN2S/c14-10-11(6-1-2-6)17-12(18-13(10)19)8-4-3-7(16)5-9(8)15/h3-6H,1-2H2,(H,17,18,19) |
| InChIKey | QKLNVLLDTBNMMB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|