C15H13Br2FN2S — CID 106482201
5-bromo-2-(3-bromo-4-fluorophenyl)-6-cyclopentyl-1H-pyrimidine-4-thione (PubChem CID 106482201) has the molecular formula C15H13Br2FN2S and a molecular weight of 432.16 g/mol. Its IUPAC name is 5-bromo-2-(3-bromo-4-fluorophenyl)-6-cyclopentyl-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(3-bromo-4-fluorophenyl)-6-cyclopentyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482201 |
| Molecular Formula | C15H13Br2FN2S |
| Molecular Weight | 432.16 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | 5-bromo-2-(3-bromo-4-fluorophenyl)-6-cyclopentyl-1H-pyrimidine-4-thione |
| SMILES | Fc1ccc(-c2nc(=S)c(Br)c(C3CCCC3)[nH]2)cc1Br |
| InChI | InChI=1S/C15H13Br2FN2S/c16-10-7-9(5-6-11(10)18)14-19-13(8-3-1-2-4-8)12(17)15(21)20-14/h5-8H,1-4H2,(H,19,20,21) |
| InChIKey | KFKLQLQFLYSOLY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.16 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|