C14H15BrN4S — CID 106482123
5-bromo-6-cyclopentyl-2-(2-methylpyrimidin-4-yl)-1H-pyrimidine-4-thione (PubChem CID 106482123) has the molecular formula C14H15BrN4S and a molecular weight of 351.27 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-(2-methylpyrimidin-4-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-(2-methylpyrimidin-4-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482123 |
| Molecular Formula | C14H15BrN4S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-(2-methylpyrimidin-4-yl)-1H-pyrimidine-4-thione |
| SMILES | Cc1nccc(-c2nc(=S)c(Br)c(C3CCCC3)[nH]2)n1 |
| InChI | InChI=1S/C14H15BrN4S/c1-8-16-7-6-10(17-8)13-18-12(9-4-2-3-5-9)11(15)14(20)19-13/h6-7,9H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | PSPIPPBJMLSENJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|