C10H14BrN3OS — CID 106480980
5-bromo-2-(4-ethylmorpholin-2-yl)-1H-pyrimidine-6-thione (PubChem CID 106480980) has the molecular formula C10H14BrN3OS and a molecular weight of 304.21 g/mol. Its IUPAC name is 5-bromo-2-(4-ethylmorpholin-2-yl)-1H-pyrimidine-6-thione.
| Compound Name | 5-bromo-2-(4-ethylmorpholin-2-yl)-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 106480980 |
| Molecular Formula | C10H14BrN3OS |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 5-bromo-2-(4-ethylmorpholin-2-yl)-1H-pyrimidine-6-thione |
| SMILES | CCN1CCOC(c2ncc(Br)c(=S)[nH]2)C1 |
| InChI | InChI=1S/C10H14BrN3OS/c1-2-14-3-4-15-8(6-14)9-12-5-7(11)10(16)13-9/h5,8H,2-4,6H2,1H3,(H,12,13,16) |
| InChIKey | DEPOLLFIGMGRKV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|