C11H14BrN3OS — CID 106480824
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-bromo-1H-pyrimidine-6-thione (PubChem CID 106480824) has the molecular formula C11H14BrN3OS and a molecular weight of 316.22 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-bromo-1H-pyrimidine-6-thione.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-bromo-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 106480824 |
| Molecular Formula | C11H14BrN3OS |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-5-bromo-1H-pyrimidine-6-thione |
| SMILES | S=c1[nH]c(C2CN3CCCC3CO2)ncc1Br |
| InChI | InChI=1S/C11H14BrN3OS/c12-8-4-13-10(14-11(8)17)9-5-15-3-1-2-7(15)6-16-9/h4,7,9H,1-3,5-6H2,(H,13,14,17) |
| InChIKey | CPBWHDTWLPRVLF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|