C14H22N4O — CID 103431987
(1S)-1-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4-methylpyrimidin-5-yl]ethanamine (PubChem CID 103431987) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (1S)-1-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4-methylpyrimidin-5-yl]ethanamine.
| Compound Name | (1S)-1-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4-methylpyrimidin-5-yl]ethanamine |
|---|---|
| PubChem CID | 103431987 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (1S)-1-[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4-methylpyrimidin-5-yl]ethanamine |
| SMILES | Cc1nc(C2CN3CCCC3CO2)ncc1[C@H](C)N |
| InChI | InChI=1S/C14H22N4O/c1-9(15)12-6-16-14(17-10(12)2)13-7-18-5-3-4-11(18)8-19-13/h6,9,11,13H,3-5,7-8,15H2,1-2H3/t9-,11?,13?/m0/s1 |
| InChIKey | SZXMLFWLYHOORB-FJJSSXBZSA-N |
| XLogP | 1.34 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |