C15H19N3O2 — CID 79096392
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 79096392) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 79096392 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | O=C1CCCc2nc(C3CN4CCCC4CO3)ncc21 |
| InChI | InChI=1S/C15H19N3O2/c19-13-5-1-4-12-11(13)7-16-15(17-12)14-8-18-6-2-3-10(18)9-20-14/h7,10,14H,1-6,8-9H2 |
| InChIKey | HCRDEOCLXVZQAF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |