C14H20N4O3 — CID 116647620
methyl 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4-amino-6-methylpyrimidine-5-carboxylate (PubChem CID 116647620) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4-amino-6-methylpyrimidine-5-carboxylate.
| Compound Name | methyl 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4-amino-6-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116647620 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | methyl 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4-amino-6-methylpyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(C)nc(C2CN3CCCC3CO2)nc1N |
| InChI | InChI=1S/C14H20N4O3/c1-8-11(14(19)20-2)12(15)17-13(16-8)10-6-18-5-3-4-9(18)7-21-10/h9-10H,3-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | JTZRNPHQKGYQGM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |