C8H9BrN2S3 — CID 106481017
5-bromo-2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione (PubChem CID 106481017) has the molecular formula C8H9BrN2S3 and a molecular weight of 309.28 g/mol. Its IUPAC name is 5-bromo-2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione.
| Compound Name | 5-bromo-2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione |
|---|---|
| PubChem CID | 106481017 |
| Molecular Formula | C8H9BrN2S3 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 307.91 |
| IUPAC Name | 5-bromo-2-(1,4-dithian-2-yl)-1H-pyrimidine-6-thione |
| SMILES | S=c1[nH]c(C2CSCCS2)ncc1Br |
| InChI | InChI=1S/C8H9BrN2S3/c9-5-3-10-7(11-8(5)12)6-4-13-1-2-14-6/h3,6H,1-2,4H2,(H,10,11,12) |
| InChIKey | QWMBOPCOWAMJRG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|