C13H21BrN4S — CID 106481031
5-bromo-2-(4-methylpiperazin-1-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione (PubChem CID 106481031) has the molecular formula C13H21BrN4S and a molecular weight of 345.31 g/mol. Its IUPAC name is 5-bromo-2-(4-methylpiperazin-1-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(4-methylpiperazin-1-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481031 |
| Molecular Formula | C13H21BrN4S |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-bromo-2-(4-methylpiperazin-1-yl)-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1[nH]c(N2CCN(C)CC2)nc(=S)c1Br |
| InChI | InChI=1S/C13H21BrN4S/c1-9(2)8-10-11(14)12(19)16-13(15-10)18-6-4-17(3)5-7-18/h9H,4-8H2,1-3H3,(H,15,16,19) |
| InChIKey | ORZRIBAZGSVYRM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|