C10H16BrN3S — CID 106481062
5-bromo-2-(dimethylamino)-6-(2-methylpropyl)-1H-pyrimidine-4-thione (PubChem CID 106481062) has the molecular formula C10H16BrN3S and a molecular weight of 290.23 g/mol. Its IUPAC name is 5-bromo-2-(dimethylamino)-6-(2-methylpropyl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-2-(dimethylamino)-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481062 |
| Molecular Formula | C10H16BrN3S |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 5-bromo-2-(dimethylamino)-6-(2-methylpropyl)-1H-pyrimidine-4-thione |
| SMILES | CC(C)Cc1[nH]c(N(C)C)nc(=S)c1Br |
| InChI | InChI=1S/C10H16BrN3S/c1-6(2)5-7-8(11)9(15)13-10(12-7)14(3)4/h6H,5H2,1-4H3,(H,12,13,15) |
| InChIKey | XBEYGPBGSTWFKL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|