C15H24BrN3OS — CID 106481044
5-bromo-6-(2-methylpropyl)-2-(4-propylmorpholin-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106481044) has the molecular formula C15H24BrN3OS and a molecular weight of 374.35 g/mol. Its IUPAC name is 5-bromo-6-(2-methylpropyl)-2-(4-propylmorpholin-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-(2-methylpropyl)-2-(4-propylmorpholin-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481044 |
| Molecular Formula | C15H24BrN3OS |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 5-bromo-6-(2-methylpropyl)-2-(4-propylmorpholin-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCCN1CCOC(c2nc(=S)c(Br)c(CC(C)C)[nH]2)C1 |
| InChI | InChI=1S/C15H24BrN3OS/c1-4-5-19-6-7-20-12(9-19)14-17-11(8-10(2)3)13(16)15(21)18-14/h10,12H,4-9H2,1-3H3,(H,17,18,21) |
| InChIKey | LFYCMNLWPQLRNH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|