C11H16N2S2 — CID 106481562
2-(3-methylbutyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481562) has the molecular formula C11H16N2S2 and a molecular weight of 240.40 g/mol. Its IUPAC name is 2-(3-methylbutyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(3-methylbutyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481562 |
| Molecular Formula | C11H16N2S2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(3-methylbutyl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | CC(C)CCc1nc(=S)c2c([nH]1)CSC2 |
| InChI | InChI=1S/C11H16N2S2/c1-7(2)3-4-10-12-9-6-15-5-8(9)11(14)13-10/h7H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | VIFNEJPPZSBNAJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|