C26H30ClN2S+ — CID 10648164
3-(2-chlorophenothiazin-10-yl)propyl-[(3,4-dimethylphenyl)methyl]-dimethylazanium (PubChem CID 10648164) has the molecular formula C26H30ClN2S+ and a molecular weight of 438.06 g/mol. Its IUPAC name is 3-(2-chlorophenothiazin-10-yl)propyl-[(3,4-dimethylphenyl)methyl]-dimethylazanium.
| Compound Name | 3-(2-chlorophenothiazin-10-yl)propyl-[(3,4-dimethylphenyl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 10648164 |
| Molecular Formula | C26H30ClN2S+ |
| Molecular Weight | 438.06 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 3-(2-chlorophenothiazin-10-yl)propyl-[(3,4-dimethylphenyl)methyl]-dimethylazanium |
| SMILES | Cc1ccc(C[N+](C)(C)CCCN2c3ccccc3Sc3ccc(Cl)cc32)cc1C |
| InChI | InChI=1S/C26H30ClN2S/c1-19-10-11-21(16-20(19)2)18-29(3,4)15-7-14-28-23-8-5-6-9-25(23)30-26-13-12-22(27)17-24(26)28/h5-6,8-13,16-17H,7,14-15,18H2,1-4H3/q+1 |
| InChIKey | NAYIMUYVNCFQLF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.06 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|