C14H10N4S2 — CID 106481777
2-quinoxalin-6-yl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481777) has the molecular formula C14H10N4S2 and a molecular weight of 298.40 g/mol. Its IUPAC name is 2-quinoxalin-6-yl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-quinoxalin-6-yl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481777 |
| Molecular Formula | C14H10N4S2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-quinoxalin-6-yl-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | S=c1nc(-c2ccc3nccnc3c2)[nH]c2c1CSC2 |
| InChI | InChI=1S/C14H10N4S2/c19-14-9-6-20-7-12(9)17-13(18-14)8-1-2-10-11(5-8)16-4-3-15-10/h1-5H,6-7H2,(H,17,18,19) |
| InChIKey | ZCHXGXMERVYUOH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|