C15H16N2O2S — CID 106477397
2-(3,4-dimethoxyphenyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 106477397) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477397 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | COc1ccc(-c2nc(=S)c3c([nH]2)CCC3)cc1OC |
| InChI | InChI=1S/C15H16N2O2S/c1-18-12-7-6-9(8-13(12)19-2)14-16-11-5-3-4-10(11)15(20)17-14/h6-8H,3-5H2,1-2H3,(H,16,17,20) |
| InChIKey | AGTRSJXJQAYKGD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|