C16H17FN2S — CID 106478763
2-(4-fluoro-3-methylphenyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione (PubChem CID 106478763) has the molecular formula C16H17FN2S and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione.
| Compound Name | 2-(4-fluoro-3-methylphenyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478763 |
| Molecular Formula | C16H17FN2S |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
| SMILES | Cc1cc(-c2nc(=S)c3c([nH]2)CCCCC3)ccc1F |
| InChI | InChI=1S/C16H17FN2S/c1-10-9-11(7-8-13(10)17)15-18-14-6-4-2-3-5-12(14)16(20)19-15/h7-9H,2-6H2,1H3,(H,18,19,20) |
| InChIKey | FUICWIWRYRPJAJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|