C16H19N3S — CID 107505164
2-(2,6-dimethyl-4-pyridinyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione (PubChem CID 107505164) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-pyridinyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione.
| Compound Name | 2-(2,6-dimethyl-4-pyridinyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 107505164 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(2,6-dimethyl-4-pyridinyl)-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
| SMILES | Cc1cc(-c2nc(=S)c3c([nH]2)CCCCC3)cc(C)n1 |
| InChI | InChI=1S/C16H19N3S/c1-10-8-12(9-11(2)17-10)15-18-14-7-5-3-4-6-13(14)16(20)19-15/h8-9H,3-7H2,1-2H3,(H,18,19,20) |
| InChIKey | BMTRNJYMAPMHIF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|