C18H22N2S — CID 106478675
2-[(3,5-dimethylphenyl)methyl]-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione (PubChem CID 106478675) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methyl]-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione.
| Compound Name | 2-[(3,5-dimethylphenyl)methyl]-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478675 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methyl]-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
| SMILES | Cc1cc(C)cc(Cc2nc(=S)c3c([nH]2)CCCCC3)c1 |
| InChI | InChI=1S/C18H22N2S/c1-12-8-13(2)10-14(9-12)11-17-19-16-7-5-3-4-6-15(16)18(21)20-17/h8-10H,3-7,11H2,1-2H3,(H,19,20,21) |
| InChIKey | IUAYASQQFHGSBM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|