C16H17ClN2S2 — CID 106478713
2-[(4-chlorophenyl)sulfanylmethyl]-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione (PubChem CID 106478713) has the molecular formula C16H17ClN2S2 and a molecular weight of 336.91 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfanylmethyl]-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione.
| Compound Name | 2-[(4-chlorophenyl)sulfanylmethyl]-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106478713 |
| Molecular Formula | C16H17ClN2S2 |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfanylmethyl]-1,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidine-4-thione |
| SMILES | S=c1nc(CSc2ccc(Cl)cc2)[nH]c2c1CCCCC2 |
| InChI | InChI=1S/C16H17ClN2S2/c17-11-6-8-12(9-7-11)21-10-15-18-14-5-3-1-2-4-13(14)16(20)19-15/h6-9H,1-5,10H2,(H,18,19,20) |
| InChIKey | TZARFEQFNRQMQM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|