C14H13ClN2S — CID 106477548
2-[(3-chlorophenyl)methyl]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 106477548) has the molecular formula C14H13ClN2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-[(3-chlorophenyl)methyl]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477548 |
| Molecular Formula | C14H13ClN2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | S=c1nc(Cc2cccc(Cl)c2)[nH]c2c1CCC2 |
| InChI | InChI=1S/C14H13ClN2S/c15-10-4-1-3-9(7-10)8-13-16-12-6-2-5-11(12)14(18)17-13/h1,3-4,7H,2,5-6,8H2,(H,16,17,18) |
| InChIKey | BUFOEJUMZPCNQQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|