C14H12ClFN2S — CID 106477460
2-[(3-chloro-2-fluorophenyl)methyl]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 106477460) has the molecular formula C14H12ClFN2S and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-[(3-chloro-2-fluorophenyl)methyl]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-[(3-chloro-2-fluorophenyl)methyl]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106477460 |
| Molecular Formula | C14H12ClFN2S |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 2-[(3-chloro-2-fluorophenyl)methyl]-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | Fc1c(Cl)cccc1Cc1nc(=S)c2c([nH]1)CCC2 |
| InChI | InChI=1S/C14H12ClFN2S/c15-10-5-1-3-8(13(10)16)7-12-17-11-6-2-4-9(11)14(19)18-12/h1,3,5H,2,4,6-7H2,(H,17,18,19) |
| InChIKey | DEMJTZMDXMGPPL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|