C10H12N2S4 — CID 106481784
2-(1,4-dithian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione (PubChem CID 106481784) has the molecular formula C10H12N2S4 and a molecular weight of 288.49 g/mol. Its IUPAC name is 2-(1,4-dithian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione.
| Compound Name | 2-(1,4-dithian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481784 |
| Molecular Formula | C10H12N2S4 |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-(1,4-dithian-2-yl)-5,7-dihydro-1H-thieno[3,4-d]pyrimidine-4-thione |
| SMILES | S=c1nc(C2CSCCS2)[nH]c2c1CSC2 |
| InChI | InChI=1S/C10H12N2S4/c13-10-6-3-15-4-7(6)11-9(12-10)8-5-14-1-2-16-8/h8H,1-5H2,(H,11,12,13) |
| InChIKey | CLAWREYOQADOCN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|