C16H26N4S — CID 106481923
6-cyclopentyl-2-(1,4-dimethyl-1,4-diazepan-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106481923) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 6-cyclopentyl-2-(1,4-dimethyl-1,4-diazepan-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopentyl-2-(1,4-dimethyl-1,4-diazepan-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106481923 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 6-cyclopentyl-2-(1,4-dimethyl-1,4-diazepan-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CN1CCCN(C)C(c2nc(=S)cc(C3CCCC3)[nH]2)C1 |
| InChI | InChI=1S/C16H26N4S/c1-19-8-5-9-20(2)14(11-19)16-17-13(10-15(21)18-16)12-6-3-4-7-12/h10,12,14H,3-9,11H2,1-2H3,(H,17,18,21) |
| InChIKey | ZINZEPZUZAZNES-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|