C17H18N2OS — CID 106482034
6-cyclopentyl-2-(2,3-dihydro-1-benzofuran-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106482034) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is 6-cyclopentyl-2-(2,3-dihydro-1-benzofuran-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-cyclopentyl-2-(2,3-dihydro-1-benzofuran-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482034 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 6-cyclopentyl-2-(2,3-dihydro-1-benzofuran-2-yl)-1H-pyrimidine-4-thione |
| SMILES | S=c1cc(C2CCCC2)[nH]c(C2Cc3ccccc3O2)n1 |
| InChI | InChI=1S/C17H18N2OS/c21-16-10-13(11-5-1-2-6-11)18-17(19-16)15-9-12-7-3-4-8-14(12)20-15/h3-4,7-8,10-11,15H,1-2,5-6,9H2,(H,18,19,21) |
| InChIKey | SURMQOAMKQFZRX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|