C11H16BrN3S — CID 106482068
5-bromo-6-cyclopentyl-2-(dimethylamino)-1H-pyrimidine-4-thione (PubChem CID 106482068) has the molecular formula C11H16BrN3S and a molecular weight of 302.24 g/mol. Its IUPAC name is 5-bromo-6-cyclopentyl-2-(dimethylamino)-1H-pyrimidine-4-thione.
| Compound Name | 5-bromo-6-cyclopentyl-2-(dimethylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106482068 |
| Molecular Formula | C11H16BrN3S |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 5-bromo-6-cyclopentyl-2-(dimethylamino)-1H-pyrimidine-4-thione |
| SMILES | CN(C)c1nc(=S)c(Br)c(C2CCCC2)[nH]1 |
| InChI | InChI=1S/C11H16BrN3S/c1-15(2)11-13-9(7-5-3-4-6-7)8(12)10(16)14-11/h7H,3-6H2,1-2H3,(H,13,14,16) |
| InChIKey | LBYWIPUYWTXJQF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|